C23H23F3N2O3S — CID 67026953
N-[2-(2-tert-butylphenoxy)-3-pyridinyl]-1-[3-(trifluoromethyl)phenyl]methanesulfonamide (PubChem CID 67026953) has the molecular formula C23H23F3N2O3S and a molecular weight of 464.51 g/mol. Its IUPAC name is N-[2-(2-tert-butylphenoxy)-3-pyridinyl]-1-[3-(trifluoromethyl)phenyl]methanesulfonamide.
| Compound Name | N-[2-(2-tert-butylphenoxy)-3-pyridinyl]-1-[3-(trifluoromethyl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 67026953 |
| Molecular Formula | C23H23F3N2O3S |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | N-[2-(2-tert-butylphenoxy)-3-pyridinyl]-1-[3-(trifluoromethyl)phenyl]methanesulfonamide |
| SMILES | CC(C)(C)c1ccccc1Oc1ncccc1NS(=O)(=O)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H23F3N2O3S/c1-22(2,3)18-10-4-5-12-20(18)31-21-19(11-7-13-27-21)28-32(29,30)15-16-8-6-9-17(14-16)23(24,25)26/h4-14,28H,15H2,1-3H3 |
| InChIKey | YRWZMBHASGYZFL-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |