C21H21N3O4 — CID 67045141
6-(1-hydroxy-3-oxo-2-piperidin-4-ylisoindol-1-yl)-4H-1,4-benzoxazin-3-one (PubChem CID 67045141) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is 6-(1-hydroxy-3-oxo-2-piperidin-4-ylisoindol-1-yl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(1-hydroxy-3-oxo-2-piperidin-4-ylisoindol-1-yl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 67045141 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 6-(1-hydroxy-3-oxo-2-piperidin-4-ylisoindol-1-yl)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(C3(O)c4ccccc4C(=O)N3C3CCNCC3)cc2N1 |
| InChI | InChI=1S/C21H21N3O4/c25-19-12-28-18-6-5-13(11-17(18)23-19)21(27)16-4-2-1-3-15(16)20(26)24(21)14-7-9-22-10-8-14/h1-6,11,14,22,27H,7-10,12H2,(H,23,25) |
| InChIKey | LQZJCFXJMJHXNY-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |