C19H11FN4O2 — CID 67052929
1-[4-(6-fluoro-3-pyridinyl)phenyl]-7-hydroxy-5-oxo-4H-pyrrolo[3,2-b]pyridine-6-carbonitrile (PubChem CID 67052929) has the molecular formula C19H11FN4O2 and a molecular weight of 346.32 g/mol. Its IUPAC name is 1-[4-(6-fluoro-3-pyridinyl)phenyl]-7-hydroxy-5-oxo-4H-pyrrolo[3,2-b]pyridine-6-carbonitrile.
| Compound Name | 1-[4-(6-fluoro-3-pyridinyl)phenyl]-7-hydroxy-5-oxo-4H-pyrrolo[3,2-b]pyridine-6-carbonitrile |
|---|---|
| PubChem CID | 67052929 |
| Molecular Formula | C19H11FN4O2 |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 1-[4-(6-fluoro-3-pyridinyl)phenyl]-7-hydroxy-5-oxo-4H-pyrrolo[3,2-b]pyridine-6-carbonitrile |
| SMILES | N#Cc1c(O)c2c(ccn2-c2ccc(-c3ccc(F)nc3)cc2)[nH]c1=O |
| InChI | InChI=1S/C19H11FN4O2/c20-16-6-3-12(10-22-16)11-1-4-13(5-2-11)24-8-7-15-17(24)18(25)14(9-21)19(26)23-15/h1-8,10H,(H2,23,25,26) |
| InChIKey | DHKNCTZGBFIRHF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 94.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|