C9H4BiN3O2 — CID 59145394
CID 59145394 (PubChem CID 59145394) has the molecular formula C9H4BiN3O2 and a molecular weight of 395.13 g/mol.
| Compound Name | CID 59145394 |
|---|---|
| PubChem CID | 59145394 |
| Molecular Formula | C9H4BiN3O2 |
| Molecular Weight | 395.13 g/mol |
| Exact Mass | 395.01 |
| IUPAC Name | — |
| SMILES | N#Cc1c(O)c2cc([Bi])cnc2[nH]c1=O |
| InChI | InChI=1S/C9H4N3O2.Bi/c10-4-6-7(13)5-2-1-3-11-8(5)12-9(6)14;/h2-3H,(H2,11,12,13,14); |
| InChIKey | PEFHCCJNKSLZLB-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.13 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |