C15H26OS — CID 67053236
2,6-dipentyl-2,3-dihydrothiopyran-4-one (PubChem CID 67053236) has the molecular formula C15H26OS and a molecular weight of 254.44 g/mol. Its IUPAC name is 2,6-dipentyl-2,3-dihydrothiopyran-4-one.
| Compound Name | 2,6-dipentyl-2,3-dihydrothiopyran-4-one |
|---|---|
| PubChem CID | 67053236 |
| Molecular Formula | C15H26OS |
| Molecular Weight | 254.44 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 2,6-dipentyl-2,3-dihydrothiopyran-4-one |
| SMILES | CCCCCC1=CC(=O)CC(CCCCC)S1 |
| InChI | InChI=1S/C15H26OS/c1-3-5-7-9-14-11-13(16)12-15(17-14)10-8-6-4-2/h11,15H,3-10,12H2,1-2H3 |
| InChIKey | DLUQVBFOMYIHRT-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.44 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|