About tetrazino[1,6-b]indazole
tetrazino[1,6-b]indazole (PubChem CID 67063068) has the molecular formula C8H5N5
and a molecular weight of 171.16 g/mol. Its IUPAC name is tetrazino[1,6-b]indazole.
Molecular Properties
| Compound Name | tetrazino[1,6-b]indazole |
| PubChem CID | 67063068 |
| Molecular Formula | C8H5N5 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | tetrazino[1,6-b]indazole |
| SMILES | c1ccc2c(c1)nn1nnncc21 |
| InChI | InChI=1S/C8H5N5/c1-2-4-7-6(3-1)8-5-9-11-12-13(8)10-7/h1-5H |
| InChIKey | JLBKPIKRFNBYTG-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tetrazino[1,6-b]indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrazino[1,6-b]indazole?
The IUPAC name of tetrazino[1,6-b]indazole (CID 67063068) is tetrazino[1,6-b]indazole.
What is the SMILES notation for tetrazino[1,6-b]indazole?
The canonical SMILES for tetrazino[1,6-b]indazole is c1ccc2c(c1)nn1nnncc21.
What is the InChIKey of tetrazino[1,6-b]indazole?
The InChIKey is JLBKPIKRFNBYTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N5/c1-2-4-7-6(3-1)8-5-9-11-12-13(8)10-7/h1-5H.
What are the key properties of tetrazino[1,6-b]indazole?
tetrazino[1,6-b]indazole has a molecular weight of 171.16 g/mol, XLogP of 0.67, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tetrazino[1,6-b]indazole is sourced from PubChem (CID 67063068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).