C31H34N4O2 — CID 67078852
4-[1-amino-2-[(4-phenylphenyl)methoxy]hexyl]-N-(2-amino-3-pyridinyl)benzamide (PubChem CID 67078852) has the molecular formula C31H34N4O2 and a molecular weight of 494.64 g/mol. Its IUPAC name is 4-[1-amino-2-[(4-phenylphenyl)methoxy]hexyl]-N-(2-amino-3-pyridinyl)benzamide.
| Compound Name | 4-[1-amino-2-[(4-phenylphenyl)methoxy]hexyl]-N-(2-amino-3-pyridinyl)benzamide |
|---|---|
| PubChem CID | 67078852 |
| Molecular Formula | C31H34N4O2 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | 4-[1-amino-2-[(4-phenylphenyl)methoxy]hexyl]-N-(2-amino-3-pyridinyl)benzamide |
| SMILES | CCCCC(OCc1ccc(-c2ccccc2)cc1)C(N)c1ccc(C(=O)Nc2cccnc2N)cc1 |
| InChI | InChI=1S/C31H34N4O2/c1-2-3-11-28(37-21-22-12-14-24(15-13-22)23-8-5-4-6-9-23)29(32)25-16-18-26(19-17-25)31(36)35-27-10-7-20-34-30(27)33/h4-10,12-20,28-29H,2-3,11,21,32H2,1H3,(H2,33,34)(H,35,36) |
| InChIKey | XFAGKJXEWZTQEZ-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |