C25H31N5O2 — CID 67079175
4-[[5-[(4-aminophenyl)methoxy]pentylamino]methyl]-N-(2-amino-3-pyridinyl)benzamide (PubChem CID 67079175) has the molecular formula C25H31N5O2 and a molecular weight of 433.56 g/mol. Its IUPAC name is 4-[[5-[(4-aminophenyl)methoxy]pentylamino]methyl]-N-(2-amino-3-pyridinyl)benzamide.
| Compound Name | 4-[[5-[(4-aminophenyl)methoxy]pentylamino]methyl]-N-(2-amino-3-pyridinyl)benzamide |
|---|---|
| PubChem CID | 67079175 |
| Molecular Formula | C25H31N5O2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 4-[[5-[(4-aminophenyl)methoxy]pentylamino]methyl]-N-(2-amino-3-pyridinyl)benzamide |
| SMILES | Nc1ccc(COCCCCCNCc2ccc(C(=O)Nc3cccnc3N)cc2)cc1 |
| InChI | InChI=1S/C25H31N5O2/c26-22-12-8-20(9-13-22)18-32-16-3-1-2-14-28-17-19-6-10-21(11-7-19)25(31)30-23-5-4-15-29-24(23)27/h4-13,15,28H,1-3,14,16-18,26H2,(H2,27,29)(H,30,31) |
| InChIKey | QHBGZIGUVBYSHX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|