C24H39P — CID 67083235
[1,1-bis(1-adamantyl)-2-methylpropan-2-yl]phosphane (PubChem CID 67083235) has the molecular formula C24H39P and a molecular weight of 358.55 g/mol. Its IUPAC name is [1,1-bis(1-adamantyl)-2-methylpropan-2-yl]phosphane.
| Compound Name | [1,1-bis(1-adamantyl)-2-methylpropan-2-yl]phosphane |
|---|---|
| PubChem CID | 67083235 |
| Molecular Formula | C24H39P |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.28 |
| IUPAC Name | [1,1-bis(1-adamantyl)-2-methylpropan-2-yl]phosphane |
| SMILES | CC(C)(P)C(C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H39P/c1-22(2,25)21(23-9-15-3-16(10-23)5-17(4-15)11-23)24-12-18-6-19(13-24)8-20(7-18)14-24/h15-21H,3-14,25H2,1-2H3 |
| InChIKey | UYEBSGMUIALABS-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|