C19H33N5O2 — CID 67092534
1-(4-cyclobutylpiperazin-1-yl)-2-(4-methoxy-1,2,4a,5,6,8,9,9a-octahydropyrimido[4,5-d]azepin-7-yl)ethanone (PubChem CID 67092534) has the molecular formula C19H33N5O2 and a molecular weight of 363.51 g/mol. Its IUPAC name is 1-(4-cyclobutylpiperazin-1-yl)-2-(4-methoxy-1,2,4a,5,6,8,9,9a-octahydropyrimido[4,5-d]azepin-7-yl)ethanone.
| Compound Name | 1-(4-cyclobutylpiperazin-1-yl)-2-(4-methoxy-1,2,4a,5,6,8,9,9a-octahydropyrimido[4,5-d]azepin-7-yl)ethanone |
|---|---|
| PubChem CID | 67092534 |
| Molecular Formula | C19H33N5O2 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.26 |
| IUPAC Name | 1-(4-cyclobutylpiperazin-1-yl)-2-(4-methoxy-1,2,4a,5,6,8,9,9a-octahydropyrimido[4,5-d]azepin-7-yl)ethanone |
| SMILES | COC1=NCNC2CCN(CC(=O)N3CCN(C4CCC4)CC3)CCC12 |
| InChI | InChI=1S/C19H33N5O2/c1-26-19-16-5-7-22(8-6-17(16)20-14-21-19)13-18(25)24-11-9-23(10-12-24)15-3-2-4-15/h15-17,20H,2-14H2,1H3 |
| InChIKey | CQWXQPXHXXTPIE-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |