C29H34N4O5 — CID 67095660
(E)-but-2-enedioic acid;N-methyl-5-(4-phenylpiperazin-1-yl)-N-quinolin-6-ylpentanamide (PubChem CID 67095660) has the molecular formula C29H34N4O5 and a molecular weight of 518.61 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-methyl-5-(4-phenylpiperazin-1-yl)-N-quinolin-6-ylpentanamide.
| Compound Name | (E)-but-2-enedioic acid;N-methyl-5-(4-phenylpiperazin-1-yl)-N-quinolin-6-ylpentanamide |
|---|---|
| PubChem CID | 67095660 |
| Molecular Formula | C29H34N4O5 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | (E)-but-2-enedioic acid;N-methyl-5-(4-phenylpiperazin-1-yl)-N-quinolin-6-ylpentanamide |
| SMILES | CN(C(=O)CCCCN1CCN(c2ccccc2)CC1)c1ccc2ncccc2c1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C25H30N4O.C4H4O4/c1-27(23-12-13-24-21(20-23)8-7-14-26-24)25(30)11-5-6-15-28-16-18-29(19-17-28)22-9-3-2-4-10-22;5-3(6)1-2-4(7)8/h2-4,7-10,12-14,20H,5-6,11,15-19H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | GALFZHJIYNWOFK-WLHGVMLRSA-N |
| XLogP | 3.90 |
| TPSA | 114.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|