C23H29NO6 — CID 6710236
ethyl 3-[3-[5-(6-hydroxyhexyl)furan-2-yl]prop-2-enoxycarbonylamino]benzoate (PubChem CID 6710236) has the molecular formula C23H29NO6 and a molecular weight of 415.49 g/mol. Its IUPAC name is ethyl 3-[3-[5-(6-hydroxyhexyl)furan-2-yl]prop-2-enoxycarbonylamino]benzoate.
| Compound Name | ethyl 3-[3-[5-(6-hydroxyhexyl)furan-2-yl]prop-2-enoxycarbonylamino]benzoate |
|---|---|
| PubChem CID | 6710236 |
| Molecular Formula | C23H29NO6 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | ethyl 3-[3-[5-(6-hydroxyhexyl)furan-2-yl]prop-2-enoxycarbonylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)OCC=Cc2ccc(CCCCCCO)o2)c1 |
| InChI | InChI=1S/C23H29NO6/c1-2-28-22(26)18-9-7-10-19(17-18)24-23(27)29-16-8-12-21-14-13-20(30-21)11-5-3-4-6-15-25/h7-10,12-14,17,25H,2-6,11,15-16H2,1H3,(H,24,27) |
| InChIKey | JUZOQHVRIHXXQL-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|