C14H14N6O — CID 67116919
8-(2,3-dihydro-1-benzofuran-6-ylmethyl)-7H-purine-2,6-diamine (PubChem CID 67116919) has the molecular formula C14H14N6O and a molecular weight of 282.31 g/mol. Its IUPAC name is 8-(2,3-dihydro-1-benzofuran-6-ylmethyl)-7H-purine-2,6-diamine.
| Compound Name | 8-(2,3-dihydro-1-benzofuran-6-ylmethyl)-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 67116919 |
| Molecular Formula | C14H14N6O |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 8-(2,3-dihydro-1-benzofuran-6-ylmethyl)-7H-purine-2,6-diamine |
| SMILES | Nc1nc(N)c2[nH]c(Cc3ccc4c(c3)OCC4)nc2n1 |
| InChI | InChI=1S/C14H14N6O/c15-12-11-13(20-14(16)19-12)18-10(17-11)6-7-1-2-8-3-4-21-9(8)5-7/h1-2,5H,3-4,6H2,(H5,15,16,17,18,19,20) |
| InChIKey | DSPTXZGHDKLHKT-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |