C27H28N2O5 — CID 67119780
3-(4,8-dimethoxynaphthalene-2-carbonyl)-6,7-dimethylspiro[1,3-benzoxazine-2,4'-piperidine]-4-one (PubChem CID 67119780) has the molecular formula C27H28N2O5 and a molecular weight of 460.53 g/mol. Its IUPAC name is 3-(4,8-dimethoxynaphthalene-2-carbonyl)-6,7-dimethylspiro[1,3-benzoxazine-2,4'-piperidine]-4-one.
| Compound Name | 3-(4,8-dimethoxynaphthalene-2-carbonyl)-6,7-dimethylspiro[1,3-benzoxazine-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 67119780 |
| Molecular Formula | C27H28N2O5 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 3-(4,8-dimethoxynaphthalene-2-carbonyl)-6,7-dimethylspiro[1,3-benzoxazine-2,4'-piperidine]-4-one |
| SMILES | COc1cc(C(=O)N2C(=O)c3cc(C)c(C)cc3OC23CCNCC3)cc2c(OC)cccc12 |
| InChI | InChI=1S/C27H28N2O5/c1-16-12-21-24(13-17(16)2)34-27(8-10-28-11-9-27)29(26(21)31)25(30)18-14-20-19(23(15-18)33-4)6-5-7-22(20)32-3/h5-7,12-15,28H,8-11H2,1-4H3 |
| InChIKey | SLADFNYBRWVBFE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|