C13H20N2O2S — CID 67120844
1,5,5-trimethyl-2-(4-methylphenyl)sulfonylimidazolidine (PubChem CID 67120844) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is 1,5,5-trimethyl-2-(4-methylphenyl)sulfonylimidazolidine.
| Compound Name | 1,5,5-trimethyl-2-(4-methylphenyl)sulfonylimidazolidine |
|---|---|
| PubChem CID | 67120844 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 1,5,5-trimethyl-2-(4-methylphenyl)sulfonylimidazolidine |
| SMILES | Cc1ccc(S(=O)(=O)C2NCC(C)(C)N2C)cc1 |
| InChI | InChI=1S/C13H20N2O2S/c1-10-5-7-11(8-6-10)18(16,17)12-14-9-13(2,3)15(12)4/h5-8,12,14H,9H2,1-4H3 |
| InChIKey | UNNWTAAFFCOTSP-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |