C25H29N3O10 — CID 67121753
[(4S,4aR,5S,5aR,12aR)-2-carbamoyl-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] methyl carbonate (PubChem CID 67121753) has the molecular formula C25H29N3O10 and a molecular weight of 531.52 g/mol. Its IUPAC name is [(4S,4aR,5S,5aR,12aR)-2-carbamoyl-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] methyl carbonate.
| Compound Name | [(4S,4aR,5S,5aR,12aR)-2-carbamoyl-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] methyl carbonate |
|---|---|
| PubChem CID | 67121753 |
| Molecular Formula | C25H29N3O10 |
| Molecular Weight | 531.52 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | [(4S,4aR,5S,5aR,12aR)-2-carbamoyl-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] methyl carbonate |
| SMILES | COC(=O)O[C@@H]1[C@H]2[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C2=C(O)c3c(O)ccc(N(C)C)c3C[C@H]21 |
| InChI | InChI=1S/C25H29N3O10/c1-27(2)11-6-7-12(29)13-9(11)8-10-14(18(13)30)21(32)25(36)16(20(10)38-24(35)37-5)17(28(3)4)19(31)15(22(25)33)23(26)34/h6-7,10,16-17,20,29-30,33,36H,8H2,1-5H3,(H2,26,34)/t10-,16-,17+,20+,25+/m1/s1 |
| InChIKey | HVQWWMOAENZEQZ-QVRQVIPZSA-N |
| XLogP | -0.21 |
| TPSA | 200.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.52 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|