C25H30N2O7 — CID 59331859
(1S,4aR,11aS,12S,12aS)-3-acetyl-1,10-bis(dimethylamino)-4,4a,6,7-tetrahydroxy-12-methyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione (PubChem CID 59331859) has the molecular formula C25H30N2O7 and a molecular weight of 470.52 g/mol. Its IUPAC name is (1S,4aR,11aS,12S,12aS)-3-acetyl-1,10-bis(dimethylamino)-4,4a,6,7-tetrahydroxy-12-methyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione.
| Compound Name | (1S,4aR,11aS,12S,12aS)-3-acetyl-1,10-bis(dimethylamino)-4,4a,6,7-tetrahydroxy-12-methyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
|---|---|
| PubChem CID | 59331859 |
| Molecular Formula | C25H30N2O7 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | (1S,4aR,11aS,12S,12aS)-3-acetyl-1,10-bis(dimethylamino)-4,4a,6,7-tetrahydroxy-12-methyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
| SMILES | CC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(N(C)C)c4C[C@H]3[C@H](C)[C@H]2[C@H](N(C)C)C1=O |
| InChI | InChI=1S/C25H30N2O7/c1-10-12-9-13-14(26(3)4)7-8-15(29)17(13)21(30)18(12)24(33)25(34)19(10)20(27(5)6)22(31)16(11(2)28)23(25)32/h7-8,10,12,19-20,29-30,32,34H,9H2,1-6H3/t10-,12-,19-,20-,25+/m0/s1 |
| InChIKey | PPBXASQFVMTJSU-UOWWTDPVSA-N |
| XLogP | 1.38 |
| TPSA | 138.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|