C18H28F4O6Sn — CID 67132431
dibutyltin(2+);bis(3,3-difluoro-1-hydroxycyclobutane-1-carboxylate) (PubChem CID 67132431) has the molecular formula C18H28F4O6Sn and a molecular weight of 535.12 g/mol. Its IUPAC name is dibutyltin(2+);bis(3,3-difluoro-1-hydroxycyclobutane-1-carboxylate).
| Compound Name | dibutyltin(2+);bis(3,3-difluoro-1-hydroxycyclobutane-1-carboxylate) |
|---|---|
| PubChem CID | 67132431 |
| Molecular Formula | C18H28F4O6Sn |
| Molecular Weight | 535.12 g/mol |
| Exact Mass | 536.08 |
| IUPAC Name | dibutyltin(2+);bis(3,3-difluoro-1-hydroxycyclobutane-1-carboxylate) |
| SMILES | CCCC[Sn+2]CCCC.O=C([O-])C1(O)CC(F)(F)C1.O=C([O-])C1(O)CC(F)(F)C1 |
| InChI | InChI=1S/2C5H6F2O3.2C4H9.Sn/c2*6-5(7)1-4(10,2-5)3(8)9;2*1-3-4-2;/h2*10H,1-2H2,(H,8,9);2*1,3-4H2,2H3;/q;;;;+2/p-2 |
| InChIKey | VSXFNBHPLZUCEH-UHFFFAOYSA-L |
| XLogP | 0.92 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.12 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|