About dibutyltin(2+);bis(2-(ethenoxymethyl)-1-hydroxycyclopropane-1-carboxylate)
dibutyltin(2+);bis(2-(ethenoxymethyl)-1-hydroxycyclopropane-1-carboxylate) (PubChem CID 67132676) has the molecular formula C22H36O8Sn
and a molecular weight of 547.23 g/mol. Its IUPAC name is dibutyltin(2+);bis(2-(ethenoxymethyl)-1-hydroxycyclopropane-1-carboxylate).
Molecular Properties
| Compound Name | dibutyltin(2+);bis(2-(ethenoxymethyl)-1-hydroxycyclopropane-1-carboxylate) |
| PubChem CID | 67132676 |
| Molecular Formula | C22H36O8Sn |
| Molecular Weight | 547.23 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | dibutyltin(2+);bis(2-(ethenoxymethyl)-1-hydroxycyclopropane-1-carboxylate) |
| SMILES | C=COCC1CC1(O)C(=O)[O-].C=COCC1CC1(O)C(=O)[O-].CCCC[Sn+2]CCCC |
| InChI | InChI=1S/2C7H10O4.2C4H9.Sn/c2*1-2-11-4-5-3-7(5,10)6(8)9;2*1-3-4-2;/h2*2,5,10H,1,3-4H2,(H,8,9);2*1,3-4H2,2H3;/q;;;;+2/p-2 |
| InChIKey | UZRNKODLBHAOTH-UHFFFAOYSA-L |
| XLogP | 0.42 |
| TPSA | 139.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 547.23 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dibutyltin(2+);bis(2-(ethenoxymethyl)-1-hydroxycyclopropane-1-carboxylate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutyltin(2+);bis(2-(ethenoxymethyl)-1-hydroxycyclopropane-1-carboxylate)?
The IUPAC name of dibutyltin(2+);bis(2-(ethenoxymethyl)-1-hydroxycyclopropane-1-carboxylate) (CID 67132676) is dibutyltin(2+);bis(2-(ethenoxymethyl)-1-hydroxycyclopropane-1-carboxylate).
What is the SMILES notation for dibutyltin(2+);bis(2-(ethenoxymethyl)-1-hydroxycyclopropane-1-carboxylate)?
The canonical SMILES for dibutyltin(2+);bis(2-(ethenoxymethyl)-1-hydroxycyclopropane-1-carboxylate) is C=COCC1CC1(O)C(=O)[O-].C=COCC1CC1(O)C(=O)[O-].CCCC[Sn+2]CCCC.
What is the InChIKey of dibutyltin(2+);bis(2-(ethenoxymethyl)-1-hydroxycyclopropane-1-carboxylate)?
The InChIKey is UZRNKODLBHAOTH-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H10O4.2C4H9.Sn/c2*1-2-11-4-5-3-7(5,10)6(8)9;2*1-3-4-2;/h2*2,5,10H,1,3-4H2,(H,8,9);2*1,3-4H2,2H3;/q;;;;+2/p-2.
What are the key properties of dibutyltin(2+);bis(2-(ethenoxymethyl)-1-hydroxycyclopropane-1-carboxylate)?
dibutyltin(2+);bis(2-(ethenoxymethyl)-1-hydroxycyclopropane-1-carboxylate) has a molecular weight of 547.23 g/mol, XLogP of 0.42, 14 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dibutyltin(2+);bis(2-(ethenoxymethyl)-1-hydroxycyclopropane-1-carboxylate) is sourced from PubChem (CID 67132676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).