C15H22O3S2 — CID 6713736
2,4-dimethyl-3-methylsulfanylpenta-1,4-diene;4-methylbenzenesulfonic acid (PubChem CID 6713736) has the molecular formula C15H22O3S2 and a molecular weight of 314.47 g/mol. Its IUPAC name is 2,4-dimethyl-3-methylsulfanylpenta-1,4-diene;4-methylbenzenesulfonic acid.
| Compound Name | 2,4-dimethyl-3-methylsulfanylpenta-1,4-diene;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 6713736 |
| Molecular Formula | C15H22O3S2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 2,4-dimethyl-3-methylsulfanylpenta-1,4-diene;4-methylbenzenesulfonic acid |
| SMILES | C=C(C)C(SC)C(=C)C.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C8H14S.C7H8O3S/c1-6(2)8(9-5)7(3)4;1-6-2-4-7(5-3-6)11(8,9)10/h8H,1,3H2,2,4-5H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | RWPMHTRIVCCZHZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|