C19H27NO2 — CID 67158837
methyl 3-[4-[1-(3-methylbutyl)pyrrolidin-2-yl]phenyl]prop-2-enoate (PubChem CID 67158837) has the molecular formula C19H27NO2 and a molecular weight of 301.43 g/mol. Its IUPAC name is methyl 3-[4-[1-(3-methylbutyl)pyrrolidin-2-yl]phenyl]prop-2-enoate.
| Compound Name | methyl 3-[4-[1-(3-methylbutyl)pyrrolidin-2-yl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 67158837 |
| Molecular Formula | C19H27NO2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | methyl 3-[4-[1-(3-methylbutyl)pyrrolidin-2-yl]phenyl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1ccc(C2CCCN2CCC(C)C)cc1 |
| InChI | InChI=1S/C19H27NO2/c1-15(2)12-14-20-13-4-5-18(20)17-9-6-16(7-10-17)8-11-19(21)22-3/h6-11,15,18H,4-5,12-14H2,1-3H3 |
| InChIKey | DWODXWBPCOUCNV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|