C18H21NO2 — CID 76728697
methyl 3-[4-(1-but-3-ynylpyrrolidin-2-yl)phenyl]prop-2-enoate (PubChem CID 76728697) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is methyl 3-[4-(1-but-3-ynylpyrrolidin-2-yl)phenyl]prop-2-enoate.
| Compound Name | methyl 3-[4-(1-but-3-ynylpyrrolidin-2-yl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 76728697 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | methyl 3-[4-(1-but-3-ynylpyrrolidin-2-yl)phenyl]prop-2-enoate |
| SMILES | C#CCCN1CCCC1c1ccc(C=CC(=O)OC)cc1 |
| InChI | InChI=1S/C18H21NO2/c1-3-4-13-19-14-5-6-17(19)16-10-7-15(8-11-16)9-12-18(20)21-2/h1,7-12,17H,4-6,13-14H2,2H3 |
| InChIKey | RYGJMZIBRCBZTB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|