C28H29N3O3 — CID 173050142
methyl 3-[4-[(2S)-1-[2-[2-(5-methyl-1,2-oxazol-3-yl)-1H-indol-3-yl]ethyl]pyrrolidin-2-yl]phenyl]prop-2-enoate (PubChem CID 173050142) has the molecular formula C28H29N3O3 and a molecular weight of 455.56 g/mol. Its IUPAC name is methyl 3-[4-[(2S)-1-[2-[2-(5-methyl-1,2-oxazol-3-yl)-1H-indol-3-yl]ethyl]pyrrolidin-2-yl]phenyl]prop-2-enoate.
| Compound Name | methyl 3-[4-[(2S)-1-[2-[2-(5-methyl-1,2-oxazol-3-yl)-1H-indol-3-yl]ethyl]pyrrolidin-2-yl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 173050142 |
| Molecular Formula | C28H29N3O3 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | methyl 3-[4-[(2S)-1-[2-[2-(5-methyl-1,2-oxazol-3-yl)-1H-indol-3-yl]ethyl]pyrrolidin-2-yl]phenyl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1ccc([C@@H]2CCCN2CCc2c(-c3cc(C)on3)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C28H29N3O3/c1-19-18-25(30-34-19)28-23(22-6-3-4-7-24(22)29-28)15-17-31-16-5-8-26(31)21-12-9-20(10-13-21)11-14-27(32)33-2/h3-4,6-7,9-14,18,26,29H,5,8,15-17H2,1-2H3/t26-/m0/s1 |
| InChIKey | UVAMKOXORRFZTE-SANMLTNESA-N |
| XLogP | 5.70 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|