C24H27N3O2 — CID 67159205
methyl (E)-3-[4-[(2S)-1-(2-pyrazolo[1,5-a]pyridin-3-ylethyl)piperidin-2-yl]phenyl]prop-2-enoate (PubChem CID 67159205) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is methyl (E)-3-[4-[(2S)-1-(2-pyrazolo[1,5-a]pyridin-3-ylethyl)piperidin-2-yl]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-[(2S)-1-(2-pyrazolo[1,5-a]pyridin-3-ylethyl)piperidin-2-yl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 67159205 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | methyl (E)-3-[4-[(2S)-1-(2-pyrazolo[1,5-a]pyridin-3-ylethyl)piperidin-2-yl]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc([C@@H]2CCCCN2CCc2cnn3ccccc23)cc1 |
| InChI | InChI=1S/C24H27N3O2/c1-29-24(28)13-10-19-8-11-20(12-9-19)22-6-2-4-15-26(22)17-14-21-18-25-27-16-5-3-7-23(21)27/h3,5,7-13,16,18,22H,2,4,6,14-15,17H2,1H3/b13-10+/t22-/m0/s1 |
| InChIKey | JEERUVFLNJUHMD-FLSMSTFGSA-N |
| XLogP | 4.29 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|