C32H34ClN3O4 — CID 67163554
2-[[2-(4-benzhydrylpiperazine-1-carbonyl)cyclohexanecarbonyl]amino]-5-chlorobenzoic acid (PubChem CID 67163554) has the molecular formula C32H34ClN3O4 and a molecular weight of 560.09 g/mol. Its IUPAC name is 2-[[2-(4-benzhydrylpiperazine-1-carbonyl)cyclohexanecarbonyl]amino]-5-chlorobenzoic acid.
| Compound Name | 2-[[2-(4-benzhydrylpiperazine-1-carbonyl)cyclohexanecarbonyl]amino]-5-chlorobenzoic acid |
|---|---|
| PubChem CID | 67163554 |
| Molecular Formula | C32H34ClN3O4 |
| Molecular Weight | 560.09 g/mol |
| Exact Mass | 559.22 |
| IUPAC Name | 2-[[2-(4-benzhydrylpiperazine-1-carbonyl)cyclohexanecarbonyl]amino]-5-chlorobenzoic acid |
| SMILES | O=C(O)c1cc(Cl)ccc1NC(=O)C1CCCCC1C(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C32H34ClN3O4/c33-24-15-16-28(27(21-24)32(39)40)34-30(37)25-13-7-8-14-26(25)31(38)36-19-17-35(18-20-36)29(22-9-3-1-4-10-22)23-11-5-2-6-12-23/h1-6,9-12,15-16,21,25-26,29H,7-8,13-14,17-20H2,(H,34,37)(H,39,40) |
| InChIKey | SYHDFXFISLWIIA-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.09 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |