C20H34O7 — CID 67172307
cyclohexane-1,2-dicarboxylic acid;5-ethyl-9-hydroxy-2-methylidenenonanoic acid (PubChem CID 67172307) has the molecular formula C20H34O7 and a molecular weight of 386.49 g/mol. Its IUPAC name is cyclohexane-1,2-dicarboxylic acid;5-ethyl-9-hydroxy-2-methylidenenonanoic acid.
| Compound Name | cyclohexane-1,2-dicarboxylic acid;5-ethyl-9-hydroxy-2-methylidenenonanoic acid |
|---|---|
| PubChem CID | 67172307 |
| Molecular Formula | C20H34O7 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | cyclohexane-1,2-dicarboxylic acid;5-ethyl-9-hydroxy-2-methylidenenonanoic acid |
| SMILES | C=C(CCC(CC)CCCCO)C(=O)O.O=C(O)C1CCCCC1C(=O)O |
| InChI | InChI=1S/C12H22O3.C8H12O4/c1-3-11(6-4-5-9-13)8-7-10(2)12(14)15;9-7(10)5-3-1-2-4-6(5)8(11)12/h11,13H,2-9H2,1H3,(H,14,15);5-6H,1-4H2,(H,9,10)(H,11,12) |
| InChIKey | WCZPDIZECOAIBU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|