C48H50OSi — CID 67206851
[2,7-bis(2-butan-2-ylphenyl)-9H-fluoren-9-yl]-dimethyl-(1-prop-2-enoxynaphthalen-2-yl)silane (PubChem CID 67206851) has the molecular formula C48H50OSi and a molecular weight of 671.01 g/mol. Its IUPAC name is [2,7-bis(2-butan-2-ylphenyl)-9H-fluoren-9-yl]-dimethyl-(1-prop-2-enoxynaphthalen-2-yl)silane.
| Compound Name | [2,7-bis(2-butan-2-ylphenyl)-9H-fluoren-9-yl]-dimethyl-(1-prop-2-enoxynaphthalen-2-yl)silane |
|---|---|
| PubChem CID | 67206851 |
| Molecular Formula | C48H50OSi |
| Molecular Weight | 671.01 g/mol |
| Exact Mass | 670.36 |
| IUPAC Name | [2,7-bis(2-butan-2-ylphenyl)-9H-fluoren-9-yl]-dimethyl-(1-prop-2-enoxynaphthalen-2-yl)silane |
| SMILES | C=CCOc1c([Si](C)(C)C2c3cc(-c4ccccc4C(C)CC)ccc3-c3ccc(-c4ccccc4C(C)CC)cc32)ccc2ccccc12 |
| InChI | InChI=1S/C48H50OSi/c1-8-29-49-47-41-22-12-11-17-34(41)25-28-46(47)50(6,7)48-44-30-35(39-20-15-13-18-37(39)32(4)9-2)23-26-42(44)43-27-24-36(31-45(43)48)40-21-16-14-19-38(40)33(5)10-3/h8,11-28,30-33,48H,1,9-10,29H2,2-7H3 |
| InChIKey | SFWXGUFUUZCMCB-UHFFFAOYSA-N |
| XLogP | 13.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.01 |
| LogP ≤ 5 | 13.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|