C42H38OSi — CID 67207793
[2,7-bis(2-methylphenyl)-9H-fluoren-9-yl]-dimethyl-(1-prop-2-enoxynaphthalen-2-yl)silane (PubChem CID 67207793) has the molecular formula C42H38OSi and a molecular weight of 586.85 g/mol. Its IUPAC name is [2,7-bis(2-methylphenyl)-9H-fluoren-9-yl]-dimethyl-(1-prop-2-enoxynaphthalen-2-yl)silane.
| Compound Name | [2,7-bis(2-methylphenyl)-9H-fluoren-9-yl]-dimethyl-(1-prop-2-enoxynaphthalen-2-yl)silane |
|---|---|
| PubChem CID | 67207793 |
| Molecular Formula | C42H38OSi |
| Molecular Weight | 586.85 g/mol |
| Exact Mass | 586.27 |
| IUPAC Name | [2,7-bis(2-methylphenyl)-9H-fluoren-9-yl]-dimethyl-(1-prop-2-enoxynaphthalen-2-yl)silane |
| SMILES | C=CCOc1c([Si](C)(C)C2c3cc(-c4ccccc4C)ccc3-c3ccc(-c4ccccc4C)cc32)ccc2ccccc12 |
| InChI | InChI=1S/C42H38OSi/c1-6-25-43-41-35-18-12-9-15-30(35)21-24-40(41)44(4,5)42-38-26-31(33-16-10-7-13-28(33)2)19-22-36(38)37-23-20-32(27-39(37)42)34-17-11-8-14-29(34)3/h6-24,26-27,42H,1,25H2,2-5H3 |
| InChIKey | DVJGAYADIYIFEZ-UHFFFAOYSA-N |
| XLogP | 10.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.85 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|