C49H58O2Si — CID 67207081
[2,7-bis(2-butylphenyl)-9H-fluoren-9-yl]-(3-tert-butyl-5-methoxy-2-prop-2-enoxyphenyl)-dimethylsilane (PubChem CID 67207081) has the molecular formula C49H58O2Si and a molecular weight of 707.09 g/mol. Its IUPAC name is [2,7-bis(2-butylphenyl)-9H-fluoren-9-yl]-(3-tert-butyl-5-methoxy-2-prop-2-enoxyphenyl)-dimethylsilane.
| Compound Name | [2,7-bis(2-butylphenyl)-9H-fluoren-9-yl]-(3-tert-butyl-5-methoxy-2-prop-2-enoxyphenyl)-dimethylsilane |
|---|---|
| PubChem CID | 67207081 |
| Molecular Formula | C49H58O2Si |
| Molecular Weight | 707.09 g/mol |
| Exact Mass | 706.42 |
| IUPAC Name | [2,7-bis(2-butylphenyl)-9H-fluoren-9-yl]-(3-tert-butyl-5-methoxy-2-prop-2-enoxyphenyl)-dimethylsilane |
| SMILES | C=CCOc1c(C(C)(C)C)cc(OC)cc1[Si](C)(C)C1c2cc(-c3ccccc3CCCC)ccc2-c2ccc(-c3ccccc3CCCC)cc21 |
| InChI | InChI=1S/C49H58O2Si/c1-10-13-19-34-21-15-17-23-39(34)36-25-27-41-42-28-26-37(40-24-18-16-22-35(40)20-14-11-2)31-44(42)48(43(41)30-36)52(8,9)46-33-38(50-7)32-45(49(4,5)6)47(46)51-29-12-3/h12,15-18,21-28,30-33,48H,3,10-11,13-14,19-20,29H2,1-2,4-9H3 |
| InChIKey | MVJKFCOMGVXHEV-UHFFFAOYSA-N |
| XLogP | 12.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.09 |
| LogP ≤ 5 | 12.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|