C26H40O5 — CID 67214986
tert-butyl 2-methyl-2-[[(3S)-3-(oxan-2-yloxy)cyclohexyl]methoxy]-3-phenylpropanoate (PubChem CID 67214986) has the molecular formula C26H40O5 and a molecular weight of 432.60 g/mol. Its IUPAC name is tert-butyl 2-methyl-2-[[(3S)-3-(oxan-2-yloxy)cyclohexyl]methoxy]-3-phenylpropanoate.
| Compound Name | tert-butyl 2-methyl-2-[[(3S)-3-(oxan-2-yloxy)cyclohexyl]methoxy]-3-phenylpropanoate |
|---|---|
| PubChem CID | 67214986 |
| Molecular Formula | C26H40O5 |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | tert-butyl 2-methyl-2-[[(3S)-3-(oxan-2-yloxy)cyclohexyl]methoxy]-3-phenylpropanoate |
| SMILES | CC(C)(C)OC(=O)C(C)(Cc1ccccc1)OCC1CCC[C@H](OC2CCCCO2)C1 |
| InChI | InChI=1S/C26H40O5/c1-25(2,3)31-24(27)26(4,18-20-11-6-5-7-12-20)29-19-21-13-10-14-22(17-21)30-23-15-8-9-16-28-23/h5-7,11-12,21-23H,8-10,13-19H2,1-4H3/t21?,22-,23?,26?/m0/s1 |
| InChIKey | DWEFZLPZSKHBIE-SITABEDOSA-N |
| XLogP | 5.45 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |