C16H24ClNO2 — CID 67216041
2-[(3-amino-4-chlorophenyl)methyl]-2,3,4,4-tetramethylpentanoic acid (PubChem CID 67216041) has the molecular formula C16H24ClNO2 and a molecular weight of 297.83 g/mol. Its IUPAC name is 2-[(3-amino-4-chlorophenyl)methyl]-2,3,4,4-tetramethylpentanoic acid.
| Compound Name | 2-[(3-amino-4-chlorophenyl)methyl]-2,3,4,4-tetramethylpentanoic acid |
|---|---|
| PubChem CID | 67216041 |
| Molecular Formula | C16H24ClNO2 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 2-[(3-amino-4-chlorophenyl)methyl]-2,3,4,4-tetramethylpentanoic acid |
| SMILES | CC(C(C)(C)C)C(C)(Cc1ccc(Cl)c(N)c1)C(=O)O |
| InChI | InChI=1S/C16H24ClNO2/c1-10(15(2,3)4)16(5,14(19)20)9-11-6-7-12(17)13(18)8-11/h6-8,10H,9,18H2,1-5H3,(H,19,20) |
| InChIKey | DACAMYFNKUFEIW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|