C24H28N6O4 — CID 67221405
ethyl 2-[4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)-1H-pyrazol-5-yl]-2-phenylacetate (PubChem CID 67221405) has the molecular formula C24H28N6O4 and a molecular weight of 464.53 g/mol. Its IUPAC name is ethyl 2-[4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)-1H-pyrazol-5-yl]-2-phenylacetate.
| Compound Name | ethyl 2-[4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)-1H-pyrazol-5-yl]-2-phenylacetate |
|---|---|
| PubChem CID | 67221405 |
| Molecular Formula | C24H28N6O4 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | ethyl 2-[4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)-1H-pyrazol-5-yl]-2-phenylacetate |
| SMILES | CCCn1c(=O)c2[nH]c(-c3cn[nH]c3C(C(=O)OCC)c3ccccc3)nc2n(CCC)c1=O |
| InChI | InChI=1S/C24H28N6O4/c1-4-12-29-21-19(22(31)30(13-5-2)24(29)33)26-20(27-21)16-14-25-28-18(16)17(23(32)34-6-3)15-10-8-7-9-11-15/h7-11,14,17H,4-6,12-13H2,1-3H3,(H,25,28)(H,26,27) |
| InChIKey | PWKBYWAPYUNKBW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 127.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |