C17H24ClNO5 — CID 67222971
tert-butyl (2R,3R)-4-[N-(2-chloroethyl)-4-methylanilino]-2,3-dihydroxy-4-oxobutanoate (PubChem CID 67222971) has the molecular formula C17H24ClNO5 and a molecular weight of 357.83 g/mol. Its IUPAC name is tert-butyl (2R,3R)-4-[N-(2-chloroethyl)-4-methylanilino]-2,3-dihydroxy-4-oxobutanoate.
| Compound Name | tert-butyl (2R,3R)-4-[N-(2-chloroethyl)-4-methylanilino]-2,3-dihydroxy-4-oxobutanoate |
|---|---|
| PubChem CID | 67222971 |
| Molecular Formula | C17H24ClNO5 |
| Molecular Weight | 357.83 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | tert-butyl (2R,3R)-4-[N-(2-chloroethyl)-4-methylanilino]-2,3-dihydroxy-4-oxobutanoate |
| SMILES | Cc1ccc(N(CCCl)C(=O)[C@H](O)[C@@H](O)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C17H24ClNO5/c1-11-5-7-12(8-6-11)19(10-9-18)15(22)13(20)14(21)16(23)24-17(2,3)4/h5-8,13-14,20-21H,9-10H2,1-4H3/t13-,14-/m1/s1 |
| InChIKey | FHUQGDGQZCDITH-ZIAGYGMSSA-N |
| XLogP | 1.63 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.83 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|