C16H21Cl2NO5 — CID 67223250
tert-butyl (2R,3R)-4-[4-chloro-N-(2-chloroethyl)anilino]-2,3-dihydroxy-4-oxobutanoate (PubChem CID 67223250) has the molecular formula C16H21Cl2NO5 and a molecular weight of 378.25 g/mol. Its IUPAC name is tert-butyl (2R,3R)-4-[4-chloro-N-(2-chloroethyl)anilino]-2,3-dihydroxy-4-oxobutanoate.
| Compound Name | tert-butyl (2R,3R)-4-[4-chloro-N-(2-chloroethyl)anilino]-2,3-dihydroxy-4-oxobutanoate |
|---|---|
| PubChem CID | 67223250 |
| Molecular Formula | C16H21Cl2NO5 |
| Molecular Weight | 378.25 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | tert-butyl (2R,3R)-4-[4-chloro-N-(2-chloroethyl)anilino]-2,3-dihydroxy-4-oxobutanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](O)[C@@H](O)C(=O)N(CCCl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H21Cl2NO5/c1-16(2,3)24-15(23)13(21)12(20)14(22)19(9-8-17)11-6-4-10(18)5-7-11/h4-7,12-13,20-21H,8-9H2,1-3H3/t12-,13-/m1/s1 |
| InChIKey | LGLZAYXXFJRJHK-CHWSQXEVSA-N |
| XLogP | 1.98 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|