C21H18N2O3 — CID 67226971
3-[5-(3-aminophenyl)furan-2-yl]-2-(3,4-dimethoxyphenyl)prop-2-enenitrile (PubChem CID 67226971) has the molecular formula C21H18N2O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is 3-[5-(3-aminophenyl)furan-2-yl]-2-(3,4-dimethoxyphenyl)prop-2-enenitrile.
| Compound Name | 3-[5-(3-aminophenyl)furan-2-yl]-2-(3,4-dimethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 67226971 |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 3-[5-(3-aminophenyl)furan-2-yl]-2-(3,4-dimethoxyphenyl)prop-2-enenitrile |
| SMILES | COc1ccc(C(C#N)=Cc2ccc(-c3cccc(N)c3)o2)cc1OC |
| InChI | InChI=1S/C21H18N2O3/c1-24-20-8-6-14(12-21(20)25-2)16(13-22)11-18-7-9-19(26-18)15-4-3-5-17(23)10-15/h3-12H,23H2,1-2H3 |
| InChIKey | UWJPLCYZTCVGJF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|