C20H23N3O3 — CID 11965496
(Z)-2-(3,4-dimethoxyphenyl)-3-[5-(4-methylpiperazin-1-yl)furan-2-yl]prop-2-enenitrile (PubChem CID 11965496) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is (Z)-2-(3,4-dimethoxyphenyl)-3-[5-(4-methylpiperazin-1-yl)furan-2-yl]prop-2-enenitrile.
| Compound Name | (Z)-2-(3,4-dimethoxyphenyl)-3-[5-(4-methylpiperazin-1-yl)furan-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 11965496 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | (Z)-2-(3,4-dimethoxyphenyl)-3-[5-(4-methylpiperazin-1-yl)furan-2-yl]prop-2-enenitrile |
| SMILES | COc1ccc(/C(C#N)=C/c2ccc(N3CCN(C)CC3)o2)cc1OC |
| InChI | InChI=1S/C20H23N3O3/c1-22-8-10-23(11-9-22)20-7-5-17(26-20)12-16(14-21)15-4-6-18(24-2)19(13-15)25-3/h4-7,12-13H,8-11H2,1-3H3/b16-12+ |
| InChIKey | QQFZZDVDDBOKLH-FOWTUZBSSA-N |
| XLogP | 3.11 |
| TPSA | 61.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_furan_B(2)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|