C15H13NO3 — CID 6299125
(Z)-2-(3,4-dimethoxyphenyl)-3-(furan-2-yl)prop-2-enenitrile (PubChem CID 6299125) has the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. Its IUPAC name is (Z)-2-(3,4-dimethoxyphenyl)-3-(furan-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-2-(3,4-dimethoxyphenyl)-3-(furan-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 6299125 |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | (Z)-2-(3,4-dimethoxyphenyl)-3-(furan-2-yl)prop-2-enenitrile |
| SMILES | COc1ccc(/C(C#N)=C/c2ccco2)cc1OC |
| InChI | InChI=1S/C15H13NO3/c1-17-14-6-5-11(9-15(14)18-2)12(10-16)8-13-4-3-7-19-13/h3-9H,1-2H3/b12-8+ |
| InChIKey | YRWVICFHMHUCPY-XYOKQWHBSA-N |
| XLogP | 3.36 |
| TPSA | 55.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|