About sodium 2-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]benzenesulfonate
sodium 2-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]benzenesulfonate (PubChem CID 23705416) has the molecular formula C17H14NNaO5S
and a molecular weight of 367.36 g/mol. Its IUPAC name is sodium 2-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]benzenesulfonate.
Molecular Properties
| Compound Name | sodium 2-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]benzenesulfonate |
| PubChem CID | 23705416 |
| Molecular Formula | C17H14NNaO5S |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | sodium 2-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]benzenesulfonate |
| SMILES | COc1ccc(/C(C#N)=C/c2ccccc2S(=O)(=O)[O-])cc1OC.[Na+] |
| InChI | InChI=1S/C17H15NO5S.Na/c1-22-15-8-7-12(10-16(15)23-2)14(11-18)9-13-5-3-4-6-17(13)24(19,20)21;/h3-10H,1-2H3,(H,19,20,21);/q;+1/p-1/b14-9+; |
| InChIKey | HFFGNNUJSPAHAQ-KYIGKLDSSA-M |
| XLogP | -0.32 |
| TPSA | 99.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]benzenesulfonate?
The IUPAC name of sodium 2-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]benzenesulfonate (CID 23705416) is sodium 2-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]benzenesulfonate.
What is the SMILES notation for sodium 2-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]benzenesulfonate?
The canonical SMILES for sodium 2-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]benzenesulfonate is COc1ccc(/C(C#N)=C/c2ccccc2S(=O)(=O)[O-])cc1OC.[Na+].
What is the InChIKey of sodium 2-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]benzenesulfonate?
The InChIKey is HFFGNNUJSPAHAQ-KYIGKLDSSA-M. The full InChI is InChI=1S/C17H15NO5S.Na/c1-22-15-8-7-12(10-16(15)23-2)14(11-18)9-13-5-3-4-6-17(13)24(19,20)21;/h3-10H,1-2H3,(H,19,20,21);/q;+1/p-1/b14-9+;.
What are the key properties of sodium 2-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]benzenesulfonate?
sodium 2-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]benzenesulfonate has a molecular weight of 367.36 g/mol, XLogP of -0.32, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]benzenesulfonate is sourced from PubChem (CID 23705416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).