C20H24ClN3O2S — CID 67226787
2-(3,4-dimethoxyphenyl)-3-[5-(4-methylpiperazin-1-yl)thiophen-2-yl]prop-2-enenitrile;hydrochloride (PubChem CID 67226787) has the molecular formula C20H24ClN3O2S and a molecular weight of 405.95 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-3-[5-(4-methylpiperazin-1-yl)thiophen-2-yl]prop-2-enenitrile;hydrochloride.
| Compound Name | 2-(3,4-dimethoxyphenyl)-3-[5-(4-methylpiperazin-1-yl)thiophen-2-yl]prop-2-enenitrile;hydrochloride |
|---|---|
| PubChem CID | 67226787 |
| Molecular Formula | C20H24ClN3O2S |
| Molecular Weight | 405.95 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-3-[5-(4-methylpiperazin-1-yl)thiophen-2-yl]prop-2-enenitrile;hydrochloride |
| SMILES | COc1ccc(C(C#N)=Cc2ccc(N3CCN(C)CC3)s2)cc1OC.Cl |
| InChI | InChI=1S/C20H23N3O2S.ClH/c1-22-8-10-23(11-9-22)20-7-5-17(26-20)12-16(14-21)15-4-6-18(24-2)19(13-15)25-3;/h4-7,12-13H,8-11H2,1-3H3;1H |
| InChIKey | IYUBADWKBMJGMP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 48.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.95 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|