C31H42N4O5S — CID 67226646
[1-[5-[2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]thiophen-2-yl]piperidin-4-yl] 4-[3-(diethylamino)propylamino]-4-oxobutanoate (PubChem CID 67226646) has the molecular formula C31H42N4O5S and a molecular weight of 582.77 g/mol. Its IUPAC name is [1-[5-[2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]thiophen-2-yl]piperidin-4-yl] 4-[3-(diethylamino)propylamino]-4-oxobutanoate.
| Compound Name | [1-[5-[2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]thiophen-2-yl]piperidin-4-yl] 4-[3-(diethylamino)propylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 67226646 |
| Molecular Formula | C31H42N4O5S |
| Molecular Weight | 582.77 g/mol |
| Exact Mass | 582.29 |
| IUPAC Name | [1-[5-[2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]thiophen-2-yl]piperidin-4-yl] 4-[3-(diethylamino)propylamino]-4-oxobutanoate |
| SMILES | CCN(CC)CCCNC(=O)CCC(=O)OC1CCN(c2ccc(C=C(C#N)c3ccc(OC)c(OC)c3)s2)CC1 |
| InChI | InChI=1S/C31H42N4O5S/c1-5-34(6-2)17-7-16-33-29(36)11-13-31(37)40-25-14-18-35(19-15-25)30-12-9-26(41-30)20-24(22-32)23-8-10-27(38-3)28(21-23)39-4/h8-10,12,20-21,25H,5-7,11,13-19H2,1-4H3,(H,33,36) |
| InChIKey | NKFNPJCZCPZGBR-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 104.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.77 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|