C29H39N3O8S2 — CID 86645822
[1-[5-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]thiophen-2-yl]piperidin-4-yl] 2-[3-(hydroxymethyl)piperidin-1-yl]acetate;methanesulfonic acid (PubChem CID 86645822) has the molecular formula C29H39N3O8S2 and a molecular weight of 621.78 g/mol. Its IUPAC name is [1-[5-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]thiophen-2-yl]piperidin-4-yl] 2-[3-(hydroxymethyl)piperidin-1-yl]acetate;methanesulfonic acid.
| Compound Name | [1-[5-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]thiophen-2-yl]piperidin-4-yl] 2-[3-(hydroxymethyl)piperidin-1-yl]acetate;methanesulfonic acid |
|---|---|
| PubChem CID | 86645822 |
| Molecular Formula | C29H39N3O8S2 |
| Molecular Weight | 621.78 g/mol |
| Exact Mass | 621.22 |
| IUPAC Name | [1-[5-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]thiophen-2-yl]piperidin-4-yl] 2-[3-(hydroxymethyl)piperidin-1-yl]acetate;methanesulfonic acid |
| SMILES | COc1ccc(/C(C#N)=C/c2ccc(N3CCC(OC(=O)CN4CCCC(CO)C4)CC3)s2)cc1OC.CS(=O)(=O)O |
| InChI | InChI=1S/C28H35N3O5S.CH4O3S/c1-34-25-7-5-21(15-26(25)35-2)22(16-29)14-24-6-8-27(37-24)31-12-9-23(10-13-31)36-28(33)18-30-11-3-4-20(17-30)19-32;1-5(2,3)4/h5-8,14-15,20,23,32H,3-4,9-13,17-19H2,1-2H3;1H3,(H,2,3,4)/b22-14+; |
| InChIKey | PSJYGHINCJJXNY-CWUUNJJBSA-N |
| XLogP | 3.55 |
| TPSA | 149.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.78 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|