C27H35N3O8S2 — CID 86645826
[1-[5-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]thiophen-2-yl]piperidin-4-yl] 2-morpholin-4-ylacetate;methanesulfonic acid (PubChem CID 86645826) has the molecular formula C27H35N3O8S2 and a molecular weight of 593.72 g/mol. Its IUPAC name is [1-[5-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]thiophen-2-yl]piperidin-4-yl] 2-morpholin-4-ylacetate;methanesulfonic acid.
| Compound Name | [1-[5-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]thiophen-2-yl]piperidin-4-yl] 2-morpholin-4-ylacetate;methanesulfonic acid |
|---|---|
| PubChem CID | 86645826 |
| Molecular Formula | C27H35N3O8S2 |
| Molecular Weight | 593.72 g/mol |
| Exact Mass | 593.19 |
| IUPAC Name | [1-[5-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]thiophen-2-yl]piperidin-4-yl] 2-morpholin-4-ylacetate;methanesulfonic acid |
| SMILES | COc1ccc(/C(C#N)=C/c2ccc(N3CCC(OC(=O)CN4CCOCC4)CC3)s2)cc1OC.CS(=O)(=O)O |
| InChI | InChI=1S/C26H31N3O5S.CH4O3S/c1-31-23-5-3-19(16-24(23)32-2)20(17-27)15-22-4-6-25(35-22)29-9-7-21(8-10-29)34-26(30)18-28-11-13-33-14-12-28;1-5(2,3)4/h3-6,15-16,21H,7-14,18H2,1-2H3;1H3,(H,2,3,4)/b20-15+; |
| InChIKey | GTBPNOMJRDKJMS-QMGGKDRNSA-N |
| XLogP | 3.18 |
| TPSA | 138.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.72 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|