C24H25Cl6N2O6PS — CID 90759858
[1-[5-[2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]thiophen-2-yl]piperidin-4-yl] bis(2,2,2-trichloroethyl) phosphate (PubChem CID 90759858) has the molecular formula C24H25Cl6N2O6PS and a molecular weight of 713.23 g/mol. Its IUPAC name is [1-[5-[2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]thiophen-2-yl]piperidin-4-yl] bis(2,2,2-trichloroethyl) phosphate.
| Compound Name | [1-[5-[2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]thiophen-2-yl]piperidin-4-yl] bis(2,2,2-trichloroethyl) phosphate |
|---|---|
| PubChem CID | 90759858 |
| Molecular Formula | C24H25Cl6N2O6PS |
| Molecular Weight | 713.23 g/mol |
| Exact Mass | 709.93 |
| IUPAC Name | [1-[5-[2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]thiophen-2-yl]piperidin-4-yl] bis(2,2,2-trichloroethyl) phosphate |
| SMILES | COc1ccc(C(C#N)=Cc2ccc(N3CCC(OP(=O)(OCC(Cl)(Cl)Cl)OCC(Cl)(Cl)Cl)CC3)s2)cc1OC |
| InChI | InChI=1S/C24H25Cl6N2O6PS/c1-34-20-5-3-16(12-21(20)35-2)17(13-31)11-19-4-6-22(40-19)32-9-7-18(8-10-32)38-39(33,36-14-23(25,26)27)37-15-24(28,29)30/h3-6,11-12,18H,7-10,14-15H2,1-2H3 |
| InChIKey | ZTCBAYYSGLIETB-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 90.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.23 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|