C24H25N2O6S- — CID 86634875
4-[1-[5-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]thiophen-2-yl]piperidin-4-yl]oxy-4-oxobutanoate (PubChem CID 86634875) has the molecular formula C24H25N2O6S- and a molecular weight of 469.54 g/mol. Its IUPAC name is 4-[1-[5-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]thiophen-2-yl]piperidin-4-yl]oxy-4-oxobutanoate.
| Compound Name | 4-[1-[5-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]thiophen-2-yl]piperidin-4-yl]oxy-4-oxobutanoate |
|---|---|
| PubChem CID | 86634875 |
| Molecular Formula | C24H25N2O6S- |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | 4-[1-[5-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]thiophen-2-yl]piperidin-4-yl]oxy-4-oxobutanoate |
| SMILES | COc1ccc(/C(C#N)=C/c2ccc(N3CCC(OC(=O)CCC(=O)[O-])CC3)s2)cc1OC |
| InChI | InChI=1S/C24H26N2O6S/c1-30-20-5-3-16(14-21(20)31-2)17(15-25)13-19-4-6-22(33-19)26-11-9-18(10-12-26)32-24(29)8-7-23(27)28/h3-6,13-14,18H,7-12H2,1-2H3,(H,27,28)/p-1/b17-13+ |
| InChIKey | CZHDXFDMWHKDOO-GHRIWEEISA-M |
| XLogP | 2.87 |
| TPSA | 111.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|