C12H20O5 — CID 67242024
(3R,4R,5S)-4-hydroxy-5-[(1R)-1-hydroxyhept-2-enyl]-3-methoxyoxolan-2-one (PubChem CID 67242024) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is (3R,4R,5S)-4-hydroxy-5-[(1R)-1-hydroxyhept-2-enyl]-3-methoxyoxolan-2-one.
| Compound Name | (3R,4R,5S)-4-hydroxy-5-[(1R)-1-hydroxyhept-2-enyl]-3-methoxyoxolan-2-one |
|---|---|
| PubChem CID | 67242024 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | (3R,4R,5S)-4-hydroxy-5-[(1R)-1-hydroxyhept-2-enyl]-3-methoxyoxolan-2-one |
| SMILES | CCCCC=C[C@@H](O)[C@@H]1OC(=O)[C@H](OC)[C@@H]1O |
| InChI | InChI=1S/C12H20O5/c1-3-4-5-6-7-8(13)10-9(14)11(16-2)12(15)17-10/h6-11,13-14H,3-5H2,1-2H3/t8-,9-,10+,11-/m1/s1 |
| InChIKey | XPMJAEZPMCGDAK-CHWFTXMASA-N |
| XLogP | 0.40 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|