C25H24N4O3 — CID 67260907
2-hydroxy-4-phenyl-3-[[2-(3-phenylpyrazol-1-yl)-3-pyridinyl]methylamino]butanoic acid (PubChem CID 67260907) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is 2-hydroxy-4-phenyl-3-[[2-(3-phenylpyrazol-1-yl)-3-pyridinyl]methylamino]butanoic acid.
| Compound Name | 2-hydroxy-4-phenyl-3-[[2-(3-phenylpyrazol-1-yl)-3-pyridinyl]methylamino]butanoic acid |
|---|---|
| PubChem CID | 67260907 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 2-hydroxy-4-phenyl-3-[[2-(3-phenylpyrazol-1-yl)-3-pyridinyl]methylamino]butanoic acid |
| SMILES | O=C(O)C(O)C(Cc1ccccc1)NCc1cccnc1-n1ccc(-c2ccccc2)n1 |
| InChI | InChI=1S/C25H24N4O3/c30-23(25(31)32)22(16-18-8-3-1-4-9-18)27-17-20-12-7-14-26-24(20)29-15-13-21(28-29)19-10-5-2-6-11-19/h1-15,22-23,27,30H,16-17H2,(H,31,32) |
| InChIKey | PPNMKVACHUNPED-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |