C20H21Cl2N2O5PS — CID 67276567
3-[(3,5-dichlorophenyl)sulfonyl-quinolin-6-ylamino]pentan-3-ylphosphonic acid (PubChem CID 67276567) has the molecular formula C20H21Cl2N2O5PS and a molecular weight of 503.34 g/mol. Its IUPAC name is 3-[(3,5-dichlorophenyl)sulfonyl-quinolin-6-ylamino]pentan-3-ylphosphonic acid.
| Compound Name | 3-[(3,5-dichlorophenyl)sulfonyl-quinolin-6-ylamino]pentan-3-ylphosphonic acid |
|---|---|
| PubChem CID | 67276567 |
| Molecular Formula | C20H21Cl2N2O5PS |
| Molecular Weight | 503.34 g/mol |
| Exact Mass | 502.03 |
| IUPAC Name | 3-[(3,5-dichlorophenyl)sulfonyl-quinolin-6-ylamino]pentan-3-ylphosphonic acid |
| SMILES | CCC(CC)(N(c1ccc2ncccc2c1)S(=O)(=O)c1cc(Cl)cc(Cl)c1)P(=O)(O)O |
| InChI | InChI=1S/C20H21Cl2N2O5PS/c1-3-20(4-2,30(25,26)27)24(17-7-8-19-14(10-17)6-5-9-23-19)31(28,29)18-12-15(21)11-16(22)13-18/h5-13H,3-4H2,1-2H3,(H2,25,26,27) |
| InChIKey | GCCAAAOTVPRAFQ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.34 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|