C23H27Cl2N2O7PS2 — CID 67276103
3-[(3,5-dichlorophenyl)sulfonyl-[5-(dimethylsulfamoyl)naphthalen-1-yl]amino]pentan-3-ylphosphonic acid (PubChem CID 67276103) has the molecular formula C23H27Cl2N2O7PS2 and a molecular weight of 609.49 g/mol. Its IUPAC name is 3-[(3,5-dichlorophenyl)sulfonyl-[5-(dimethylsulfamoyl)naphthalen-1-yl]amino]pentan-3-ylphosphonic acid.
| Compound Name | 3-[(3,5-dichlorophenyl)sulfonyl-[5-(dimethylsulfamoyl)naphthalen-1-yl]amino]pentan-3-ylphosphonic acid |
|---|---|
| PubChem CID | 67276103 |
| Molecular Formula | C23H27Cl2N2O7PS2 |
| Molecular Weight | 609.49 g/mol |
| Exact Mass | 608.04 |
| IUPAC Name | 3-[(3,5-dichlorophenyl)sulfonyl-[5-(dimethylsulfamoyl)naphthalen-1-yl]amino]pentan-3-ylphosphonic acid |
| SMILES | CCC(CC)(N(c1cccc2c(S(=O)(=O)N(C)C)cccc12)S(=O)(=O)c1cc(Cl)cc(Cl)c1)P(=O)(O)O |
| InChI | InChI=1S/C23H27Cl2N2O7PS2/c1-5-23(6-2,35(28,29)30)27(36(31,32)18-14-16(24)13-17(25)15-18)21-11-7-10-20-19(21)9-8-12-22(20)37(33,34)26(3)4/h7-15H,5-6H2,1-4H3,(H2,28,29,30) |
| InChIKey | GNCBZVGBCPBDBW-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.49 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|