C21H23Cl2N2O5PS — CID 59534042
3,5-dichloro-N-(diethoxyphosphorylmethyl)-N-(3-methylquinolin-5-yl)benzenesulfonamide (PubChem CID 59534042) has the molecular formula C21H23Cl2N2O5PS and a molecular weight of 517.37 g/mol. Its IUPAC name is 3,5-dichloro-N-(diethoxyphosphorylmethyl)-N-(3-methylquinolin-5-yl)benzenesulfonamide.
| Compound Name | 3,5-dichloro-N-(diethoxyphosphorylmethyl)-N-(3-methylquinolin-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 59534042 |
| Molecular Formula | C21H23Cl2N2O5PS |
| Molecular Weight | 517.37 g/mol |
| Exact Mass | 516.04 |
| IUPAC Name | 3,5-dichloro-N-(diethoxyphosphorylmethyl)-N-(3-methylquinolin-5-yl)benzenesulfonamide |
| SMILES | CCOP(=O)(CN(c1cccc2ncc(C)cc12)S(=O)(=O)c1cc(Cl)cc(Cl)c1)OCC |
| InChI | InChI=1S/C21H23Cl2N2O5PS/c1-4-29-31(26,30-5-2)14-25(32(27,28)18-11-16(22)10-17(23)12-18)21-8-6-7-20-19(21)9-15(3)13-24-20/h6-13H,4-5,14H2,1-3H3 |
| InChIKey | SFISFGXCBNZYHQ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.37 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|