C15H18F2N2O5 — CID 67283023
2-[4-[3-(difluoromethyl)-4-nitroanilino]cyclohexyl]oxyacetic acid (PubChem CID 67283023) has the molecular formula C15H18F2N2O5 and a molecular weight of 344.31 g/mol. Its IUPAC name is 2-[4-[3-(difluoromethyl)-4-nitroanilino]cyclohexyl]oxyacetic acid.
| Compound Name | 2-[4-[3-(difluoromethyl)-4-nitroanilino]cyclohexyl]oxyacetic acid |
|---|---|
| PubChem CID | 67283023 |
| Molecular Formula | C15H18F2N2O5 |
| Molecular Weight | 344.31 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 2-[4-[3-(difluoromethyl)-4-nitroanilino]cyclohexyl]oxyacetic acid |
| SMILES | O=C(O)COC1CCC(Nc2ccc([N+](=O)[O-])c(C(F)F)c2)CC1 |
| InChI | InChI=1S/C15H18F2N2O5/c16-15(17)12-7-10(3-6-13(12)19(22)23)18-9-1-4-11(5-2-9)24-8-14(20)21/h3,6-7,9,11,15,18H,1-2,4-5,8H2,(H,20,21) |
| InChIKey | BCBLVHVRSXUDJC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|